This chemical's CAS registry number is 17514-61-3 and it also known as Benzo[b]thiophene-2-carboxylic acid, 3-methyl-5-nitro-. This chemical's molecular formula is C₁₀H₇NO₄S and molecular weight is 237.2319. What's more, both the product name and systematic name are the same which is called 3-Methyl-5-nitro-1-benzothiophene-2-carboxylic acid.

Physical properties about 3-Methyl-5-nitro-benzothiophene-2-carboxylic acid are: (1)ACD/LogP: 3.06; (2)#of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.36; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 2.41; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 5; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 2; (11)Polar Surface Area: 100.36 Å²; (12)Index of Refraction: 1.721; (13)Molar Refractivity: 60.78 cm³; (14)Molar Volume: 153.6 cm³; (15)Polarizability: 24.09×10^-24 cm³; (16)Surface Tension: 73.2 dyne/cm; (17)Density: 1.543 g/cm³; (18)Flash Point: 238.9 °C; (19)Enthalpy of Vaporization: 77.33 kJ/mol; (20)Boiling Point: 471.3 °C at 760 mmHg; (21)Vapour Pressure: 1.09E-09 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: [O-][N+](=O)c2cc1c(sc(c1C)C(=O)O)cc2
(2) InChI: InChI=1/C10H7NO4S/c1-5-7-4-6(11(14)15)2-3-8(7)16-9(5)10(12)13/h2-4H,1H3,(H,12,13)
(3) InChIKey: MPHOQACYYKZYIG-UHFFFAOYAC