The CAS register number of 4-(Pyrid-2-yloxy)benzoic acid is 51363-00-9. It also can be called as 4-(2-pyridinyloxy)benzoic acid. The molecular formula about this chemical is C₁₂H₉NO₃ and the molecular weight is 215.2.

Physical properties about 4-(Pyrid-2-yloxy)benzoic acid are: (1)ACD/LogP: 2.14; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 7; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 4; (7)#H bond donors: 1; (8)#Freely Rotating Bonds: 3; (9)Polar Surface Area: 59.42 Å²; (10)Index of Refraction: 1.613; (11)Molar Refractivity: 57.718 cm³; (12)Molar Volume: 165.774 cm³; (13)Polarizability: 22.881x10^-24cm³; (14)Surface Tension: 56.59 dyne/cm; (15)Density: 1.298 g/cm³; (16)Flash Point: 190.396 °C; (17)Enthalpy of Vaporization: 67.583 kJ/mol; (18)Boiling Point: 391.208 °C at 760 mmHg. 

You can still convert the following datas into molecular structure:
(1)SMILES: OC(=O)c1ccc(cc1)Oc2ccccn2
(2)InChI: InChI=1/C12H9NO3/c14-12(15)9-4-6-10(7-5-9)16-11-3-1-2-8-13-11/h1-8H,(H,14,15)
(3)InChIKey: GKSKQZLHPWBLJL-UHFFFAOYAZ
(4)Std. InChI: InChI=1S/C12H9NO3/c14-12(15)9-4-6-10(7-5-9)16-11-3-1-2-8-13-11/h1-8H,(H,14,15)
(5)Std. InChIKey: GKSKQZLHPWBLJL-UHFFFAOYSA-N