The Benzene,1,1'-sulfinylbis[4-methyl-, with CAS registry number 1774-35-2, belongs to the following product categories: (1)Organic Building Blocks; (2)Sulfoxides; (3)Sulfur Compounds. It has the systematic name of 1,1'-sulfinylbis(4-methylbenzene). What's more, its EINECS is 217-203-7.

Physical properties of Benzene,1,1'-sulfinylbis[4-methyl-: (1)ACD/LogP: 2.98; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.98; (4)ACD/LogD (pH 7.4): 2.98; (5)ACD/BCF (pH 5.5): 108.37; (6)ACD/BCF (pH 7.4): 108.37; (7)ACD/KOC (pH 5.5): 995.87; (8)ACD/KOC (pH 7.4): 995.87; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 36.28 Å²; (13)Index of Refraction: 1.641; (14)Molar Refractivity: 69.58 cm³; (15)Molar Volume: 192.8 cm³; (16)Polarizability: 27.58×10^-24cm³; (17)Surface Tension: 55.7 dyne/cm; (18)Enthalpy of Vaporization: 60.16 kJ/mol; (19)Vapour Pressure: 1.39E-05 mmHg at 25°C.

Preparation: this chemical can be prepared by methylbenzene. This reaction will need reagents AlCl₃, thionyl chloride.

Uses of Benzene,1,1'-sulfinylbis[4-methyl-: it can be used to produce di-p-tolyl sulfone. This reaction will need reagent C₆H₅C(O)NCl₂ and solvent CCl₄. The yield is about 93%.

You can still convert the following datas into molecular structure:
(1)SMILES: O=S(c1ccc(cc1)C)c2ccc(cc2)C
(2)InChI: InChI=1/C14H14OS/c1-11-3-7-13(8-4-11)16(15)14-9-5-12(2)6-10-14/h3-10H,1-2H3
(3)InChIKey: MJWNJEJCQHNDNM-UHFFFAOYAT
(4)Std. InChI: InChI=1S/C14H14OS/c1-11-3-7-13(8-4-11)16(15)14-9-5-12(2)6-10-14/h3-10H,1-2H3
(5)Std. InChIKey: MJWNJEJCQHNDNM-UHFFFAOYSA-N

The toxicity data is as follows: