The 4-Quinolinol, 6-nitro-, with the CAS registry number 23432-42-0, is also known as 4-Hydroxy-6-nitroquinoline. This chemical's molecular formula is C₉H₆N₂O₃ and molecular weight is 190.1555. Its systematic name is called 6-nitroquinolin-4(1H)-one.

Physical properties of 4-Quinolinol, 6-nitro-: (1)ACD/LogP: 2.96; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1.93; (5)ACD/KOC (pH 7.4): 1.9; (6)#H bond acceptors: 5; (7)#H bond donors: 1; (8)#Freely Rotating Bonds: 1; (9)Index of Refraction: 1.636; (10)Molar Refractivity: 48.05 cm³; (11)Molar Volume: 133.9 cm³; (12)Surface Tension: 58.6 dyne/cm; (13)Density: 1.419 g/cm³; (14)Flash Point: 173.1 °C; (15)Enthalpy of Vaporization: 60.86 kJ/mol; (16)Boiling Point: 362.6 °C at 760 mmHg; (17)Vapour Pressure: 1.91E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: [O-][N+](=O)c2ccc1c(C(=O)\C=C/N1)c2
(2)InChI: InChI=1/C9H6N2O3/c12-9-3-4-10-8-2-1-6(11(13)14)5-7(8)9/h1-5H,(H,10,12)
(3)InChIKey: MGCGVNRWZOHFTO-UHFFFAOYAQ