The 1H-Pyrrolo[2,3-b]pyridine,4-nitro-, with the CAS registry number 83683-82-3, is also known as 4-Nitro-7-azaindole. This chemical's molecular formula is C₇H₅N₃O₂ and molecular weight is 163.1335. What's more, its systematic name is called 4-Nitro-1H-pyrrolo[2,3-b]pyridine.

Physical properties about 1H-Pyrrolo[2,3-b]pyridine,4-nitro- are: (1)ACD/LogP: 1.80; (2)#of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.8; (4)ACD/LogD (pH 7.4): 1.8; (5)ACD/BCF (pH 5.5): 13.65; (6)ACD/BCF (pH 7.4): 13.65; (7)ACD/KOC (pH 5.5): 225.97; (8)ACD/KOC (pH 7.4): 225.96; (9)#H bond acceptors: 5; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 63.64 Å²; (13)Index of Refraction: 1.74; (14)Molar Refractivity: 43.16 cm³; (15)Molar Volume: 106.9 cm³; (16)Polarizability: 17.11×10^-24 cm³; (17)Surface Tension: 80.5 dyne/cm; (18)Density: 1.525 g/cm³.

You can still convert the following datas into molecular structure:
(1) SMILES: [O-][N+](=O)c1ccnc2c1ccn2
(2) InChI: InChI=1/C7H5N3O2/c11-10(12)6-2-4-9-7-5(6)1-3-8-7/h1-4H,(H,8,9)
(3) InChIKey: ULDUNXDRDOJMJZ-UHFFFAOYAX