The 4-Pyrimidinamine,2-methoxy-5-nitro-, with the CAS registry number 304646-29-5, is also known as 2-Methoxy-5-Nitro-4-Pyrimidinamine. This chemical's molecular formula is C₅H₆N₄O₃ and molecular weight is 170.1261. Its systematic name is called 2-methoxy-5-nitropyrimidin-4-amine.

Physical properties of 4-Pyrimidinamine,2-methoxy-5-nitro-: (1)ACD/LogP: -0.17; (2)ACD/LogD (pH 5.5): -0.17; (3)ACD/LogD (pH 7.4): -0.17; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 19.27; (7)ACD/KOC (pH 7.4): 19.28; (8)#H bond acceptors: 7; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.617; (12)Molar Refractivity: 39.89 cm³; (13)Molar Volume: 114 cm³; (14)Surface Tension: 73.2 dyne/cm; (15)Density: 1.492 g/cm³; (16)Flash Point: 193.8 °C; (17)Enthalpy of Vaporization: 64.73 kJ/mol; (18)Boiling Point: 396.9 °C at 760 mmHg; (19)Vapour Pressure: 1.65E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: [O-][N+](=O)c1cnc(OC)nc1N
(2)InChI: InChI=1/C5H6N4O3/c1-12-5-7-2-3(9(10)11)4(6)8-5/h2H,1H3,(H2,6,7,8)
(3)InChIKey: NTYPCKIDOSPATQ-UHFFFAOYAB