The 4-Pyrimidinamine,5-bromo-6-chloro-, with the CAS registry number 663193-80-4, is also known as 4-Amino-5-bromo-6-chloropyrimidine. This chemical's molecular formula is C₄H₃BrClN₃ and molecular weight is 208.44. Its systematic name is called 5-Bromo-6-chloropyrimidin-4-amine.

Physical properties of 4-Pyrimidinamine,5-bromo-6-chloro-: (1)ACD/LogP: 2.23; (2)ACD/LogD (pH 5.5): 2.23; (3)ACD/LogD (pH 7.4): 2.23; (4)ACD/BCF (pH 5.5): 28.93; (5)ACD/BCF (pH 7.4): 28.93; (6)ACD/KOC (pH 5.5): 386.9; (7)ACD/KOC (pH 7.4): 386.9; (8)#H bond acceptors: 3; (9)#H bond donors: 2; (10)Index of Refraction: 1.66; (11)Molar Refractivity: 39.25 cm³; (12)Molar Volume: 106.2 cm³; (13)Surface Tension: 70.2 dyne/cm; (14)Density: 1.96 g/cm³; (15)Flash Point: 155.3 °C; (16)Enthalpy of Vaporization: 57.6 kJ/mol; (17)Boiling Point: 333.1 °C at 760 mmHg; (18)Vapour Pressure: 0.000139 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1nc(c(c(n1)Cl)Br)N
(2)InChI: InChI=1/C4H3BrClN3/c5-2-3(6)8-1-9-4(2)7/h1H,(H2,7,8,9)
(3)InChIKey: DQSBRYJETNYGCI-UHFFFAOYAN