This product is an organic compound with the formula C₁₁H₁₂O₂. The IUPAC name of this chemical is 5,6,7,8-tetrahydronaphthalene-1-carboxylic acid. With the CAS registry number 4242-18-6, it is also named as 1-naphthalenecarboxylic acid, 5,6,7,8-tetrahydro-. The product's categories are Naphthalene Derivatives; Intermediates of palonosetron Hydrochloride; Organic Acids; API Intermediates. In addition, the molecular weight is 176.21. 

The other characteristics of 5,6,7,8-Tetrahydronaphthalene-1-carboxylic acid can be summarized as: (1)ACD/LogP: 3.58; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.32; (4)ACD/LogD (pH 7.4): 0.74; (5)ACD/BCF (pH 5.5): 17.05; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 116.28; (8)ACD/KOC (pH 7.4): 3.02; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 26.3 Å²; (13)Index of Refraction: 1.586; (14)Molar Refractivity: 49.96 cm³; (15)Molar Volume: 148.7 cm³; (16)Polarizability: 19.8×10^-24 cm³; (17)Surface Tension: 49.9 dyne/cm; (18)Density: 1.184 g/cm³; (19)Flash Point: 154.2 °C; (20)Enthalpy of Vaporization: 61.21 kJ/mol; (21)Boiling Point: 336.8 °C at 760 mmHg; (22)Vapour Pressure: 4.3E-05 mmHg at 25°C.

People can use the following data to convert to the molecule structure. 
1. SMILES:O=C(O)c1cccc2c1CCCC2
2. InChI:InChI=1/C11H12O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7H,1-2,4,6H2,(H,12,13)
3. InChIKey:GCFQXKYHWFWGSB-UHFFFAOYAC
4. Std. InChI:InChI=1S/C11H12O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7H,1-2,4,6H2,(H,12,13)
5. Std. InChIKey:GCFQXKYHWFWGSB-UHFFFAOYSA-N