With the CAS registry number 930298-25-2, the systematic name of this chemical is (5-amino-4-chloro-2-methyl-phenyl) ethyl carbonate. It is an organic compound which the molecular formula is C₁₀H₁₂ClNO₃ and the molecular weight is 229.66. Additionally, this chemical should be avoided direct sunshine.

The other characteristics of 5-Amino-4-chloro-2-methylphenyl ethyl carbonate can be summarized as: (1)ACD/LogP: 1.99; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.987; (4)ACD/LogD (pH 7.4): 1.987; (5)ACD/BCF (pH 5.5): 19.052; (6)ACD/BCF (pH 7.4): 19.059; (7)ACD/KOC (pH 5.5): 286.919; (8)ACD/KOC (pH 7.4): 287.024; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 61.55 Å²; (13)Index of Refraction: 1.555; (14)Molar Refractivity: 57.928 cm³; (15)Molar Volume: 180.437 cm³; (16)Polarizability: 22.964×10^-24 cm³; (17)Surface Tension: 45.098 dyne/cm; (18)Density: 1.273 g/cm³; (19)Flash Point: 165.564 °C; (20)Enthalpy of Vaporization: 59.472 kJ/mol; (21)Boiling Point: 350.149 °C at 760 mmHg; (22)Vapour Pressure: 0 mmHg at 25°C.

People can use the following data to convert to the molecule structure.
1. SMILES:CCOC(=O)Oc1cc(c(cc1C)Cl)N
2. InChI:InChI=1/C10H12ClNO3/c1-3-14-10(13)15-9-5-8(12)7(11)4-6(9)2/h4-5H,3,12H2,1-2H3
3. InChIKey:OUVLLFXUJXYMCI-UHFFFAOYAQ
4. Std. InChI:InChI=1S/C10H12ClNO3/c1-3-14-10(13)15-9-5-8(12)7(11)4-6(9)2/h4-5H,3,12H2,1-2H3
5. Std. InChIKey:OUVLLFXUJXYMCI-UHFFFAOYSA-N