The CAS registry number of 5-Bromo-2-ethylaminopyridine is 856850-36-7. This chemical's molecular formula is C₇H₉BrN₂ and molecular weight is 201.0638. Its systematic name is called 5-bromo-N-ethylpyridin-2-amine. What's more, this chemical should be stored at room temperature.

Physical properties of 5-Bromo-2-ethylaminopyridine: (1)ACD/LogP: 2.07; (2)ACD/LogD (pH 5.5): 3; (3)ACD/LogD (pH 7.4): 3; (4)ACD/BCF (pH 5.5): 48; (5)ACD/BCF (pH 7.4): 114; (6)ACD/KOC (pH 5.5): 428; (7)ACD/KOC (pH 7.4): 1030; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.603; (12)Molar Refractivity: 46.277 cm³; (13)Molar Volume: 134.805 cm³; (14)Surface Tension: 45.75 dyne/cm; (15)Density: 1.491 g/cm³; (16)Flash Point: 110.473 °C; (17)Enthalpy of Vaporization: 49.668 kJ/mol; (18)Boiling Point: 259.055 °C at 760 mmHg; (19)Vapour Pressure: 0.013 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: CCNc1ccc(Br)cn1
(2)InChI: InChI=1/C7H9BrN2/c1-2-9-7-4-3-6(8)5-10-7/h3-5H,2H2,1H3,(H,9,10)
(3)InChIKey: PTXWZJGCLYCDFV-UHFFFAOYAQ