This product is an organic compound with the formula C₈H₄ClF₃O₂. The IUPAC name of this chemical is 5-chloro-2-(trifluoromethoxy)benzaldehyde. With the CAS registry number 1092461-15-8, it is also named as Benzaldehyde, 5-chloro-2-(trifluoromethoxy)-. In addition, the molecular weight is 224.56.

The other characteristics of 5-Chloro-2-(trifluoromethoxy)benzaldehyde can be summarized as: (1)ACD/LogP: 3.86; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.857; (4)ACD/LogD (pH 7.4): 3.857; (5)ACD/BCF (pH 5.5): 502.746; (6)ACD/BCF (pH 7.4): 502.746; (7)ACD/KOC (pH 5.5): 2986.952; (8)ACD/KOC (pH 7.4): 2986.952; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 26.3 Å²; (13)Index of Refraction: 1.499; (14)Molar Refractivity: 45.036 cm³; (15)Molar Volume: 153.444 cm³; (16)Polarizability: 17.854×10^-24 cm³; (17)Surface Tension: 33.258 dyne/cm; (18)Density: 1.463 g/cm³; (19)Flash Point: 89.511 °C; (20)Enthalpy of Vaporization: 45.758 kJ/mol; (21)Boiling Point: 221.139 °C at 760 mmHg; (22)Vapour Pressure: 0.109 mmHg at 25°C.

People can use the following data to convert to the molecule structure. 
1. SMILES:c1cc(c(cc1Cl)C=O)OC(F)(F)F
2. InChI:InChI=1/C8H4ClF3O2/c9-6-1-2-7(5(3-6)4-13)14-8(10,11)12/h1-4H
3. InChIKey:VJRCCSALVWMZAN-UHFFFAOYAA
4. Std. InChI:InChI=1S/C8H4ClF3O2/c9-6-1-2-7(5(3-6)4-13)14-8(10,11)12/h1-4H 
5. Std. InChIKey:VJRCCSALVWMZAN-UHFFFAOYSA-N