The CAS registry number of 6-(1-Bromo-ethyl)-4-chloro-5-fluoropyrimidine is 188416-30-0. This chemical is also known as Pyrimidine, 4-(1-bromoethyl)-2,6-dichloro-5-fluoro-. The molecular formula of it is C₆H₄BrCl₂FN₂ and molecular weight is 273.9178. Its systematic name is called 4-(1-bromoethyl)-2,6-dichloro-5-fluoropyrimidine.

Physical properties about this chemical are: (1)ACD/LogP: 1.94; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2; (4)ACD/LogD (pH 7.4): 2; (5)ACD/BCF (pH 5.5): 37; (6)ACD/BCF (pH 7.4): 37; (7)ACD/KOC (pH 5.5): 460; (8)ACD/KOC (pH 7.4): 460; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Index of Refraction: 1.571; (13)Molar Refractivity: 49.503 cm³; (14)Molar Volume: 150.739 cm³; (15)Surface Tension: 50.495 dyne/cm; (16)Density: 1.817 g/cm³; (17)Flash Point: 130.553 °C; (18)Enthalpy of Vaporization: 51.044 kJ/mol; (19)Boiling Point: 292.258 °C at 760 mmHg; (20)Vapour Pressure: 0.003 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: CC(Br)c1nc(Cl)nc(Cl)c1F
(2)InChI: InChI=1/C6H4BrCl2FN2/c1-2(7)4-3(10)5(8)12-6(9)11-4/h2H,1H3
(3)InChIKey: AZJXRKANGIKJQD-UHFFFAOYAI