The CAS registry number of 6-(4-Fluorophenyl)-3-hydrazinyl-1,2,4-triazine is 71347-59-6. This chemical is also known as 1-(6-(4-Fluorophenyl)-1,2,4-triazin-3-yl)hydrazine. The molecular formula of it is C₉H₈FN₅ and molecular weight is 205.1917. Its systematic name is called 6-(4-fluorophenyl)-3-hydrazino-1,2,4-triazine.

Physical properties about this chemical are: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 22.06; (4)ACD/KOC (pH 7.4): 22.13; (5)#H bond acceptors: 5; (6)#H bond donors: 3; (7)#Freely Rotating Bonds: 2; (8)Index of Refraction: 1.66; (9)Molar Refractivity: 53.62 cm³; (10)Molar Volume: 145.2 cm³; (11)Surface Tension: 68.8 dyne/cm; (12)Density: 1.412 g/cm³; (13)Flash Point: 215.8 °C; (14)Enthalpy of Vaporization: 68.91 kJ/mol; (15)Boiling Point: 433.2 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: Fc1ccc(cc1)c2cnc(NN)nn2
(2)InChI: InChI=1/C9H8FN5/c10-7-3-1-6(2-4-7)8-5-12-9(13-11)15-14-8/h1-5H,11H2,(H,12,13,15)
(3)InChIKey: FSBQFNJWWOCMJL-UHFFFAOYAM