The CAS registry number of 6-(Hydroxymethyl)-2-pyridinecarbonitrile is 50501-38-7. This chemical is also known as 6-Hydroxymethyl-2-cyano-pyridine. The molecular formula of it is C₇H₆N₂O and molecular weight is 134.14. Its systematic name is called 6-(hydroxymethyl)pyridine-2-carbonitrile.

Physical properties about this chemical are: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 10; (4)ACD/KOC (pH 7.4): 10; (5)#H bond acceptors: 3; (6)#H bond donors: 1; (7)#Freely Rotating Bonds: 2; (8)Index of Refraction: 1.575; (9)Molar Refractivity: 35.279 cm³; (10)Molar Volume: 106.708 cm³; (11)Surface Tension: 65.758 dyne/cm; (12)Density: 1.257 g/cm³; (13)Flash Point: 141.573 °C; (14)Enthalpy of Vaporization: 58.21 kJ/mol; (15)Boiling Point: 310.478 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: OCc1cccc(C#N)n1
(2)InChI: InChI=1/C7H6N2O/c8-4-6-2-1-3-7(5-10)9-6/h1-3,10H,5H2
(3)InChIKey: VNXYECKZHAPGDI-UHFFFAOYAI