The CAS registry number of 6-Chloro-N-cyclopropyl-3-nitropyridin-2-amine is 380378-95-0. Its molecular formula is C₈H₈ClN₃O₂ and molecular weight is 213.621. Its systematic name is called 6-Chloro-N-cyclopropyl-3-nitropyridin-2-amine.

Physical properties about 6-Chloro-N-cyclopropyl-3-nitropyridin-2-amine are: (1)ACD/LogP: 3.39; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.39; (4)ACD/LogD (pH 7.4): 3.39; (5)ACD/BCF (pH 5.5): 222.4; (6)ACD/BCF (pH 7.4): 222.4; (7)ACD/KOC (pH 5.5): 1666.02; (8)ACD/KOC (pH 7.4): 1666.02; (9)#H bond acceptors: 5; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 2; (12)Index of Refraction: 1.705; (13)Molar Refractivity: 52.59 cm³; (14)Molar Volume: 135.1 cm³; (15)Surface Tension: 75.8 dyne/cm; (16)Density: 1.58 g/cm³; (17)Flash Point: 179.9 °C; (18)Enthalpy of Vaporization: 62.12 kJ/mol; (19)Boiling Point: 373.9 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: O=N(=O)c2ccc(Cl)nc2NC1CC1
(2)InChI: InChI=1/C8H8ClN3O2/c9-7-4-3-6(12(13)14)8(11-7)10-5-1-2-5/h3-5H,1-2H2,(H,10,11)
(3)InChIKey: FYIAEAAQBSHDPC-UHFFFAOYAC