The CAS registry number of 6-Fluoro-1H-pyrrolo[3,2-c]pyridine is 1082041-03-9. Its molecular formula is C₇H₅FN₂ and molecular weight is 136.1264. Its systematic name is called 6-fluoro-1H-pyrrolo[3,2-c]pyridine.

Physical properties about 6-Fluoro-1H-pyrrolo[3,2-c]pyridine are: (1)ACD/LogP: 1.56; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.399; (4)ACD/LogD (pH 7.4): 1.493; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 7.712; (7)ACD/KOC (pH 5.5): 11.565; (8)ACD/KOC (pH 7.4): 143.331; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 0; (12)Index of Refraction: 1.659; (13)Molar Refractivity: 36.614 cm³; (14)Molar Volume: 99.305 cm³; (15)Surface Tension: 56.271 dyne/cm; (16)Density: 1.371 g/cm³; (17)Flash Point: 143.273 °C; (18)Enthalpy of Vaporization: 53.226 kJ/mol; (19)Boiling Point: 313.29 °C at 760 mmHg; (20)Vapour Pressure: 0.001 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1c[nH]c2c1cnc(c2)F
(2)InChI: InChI=1/C7H5FN2/c8-7-3-6-5(4-10-7)1-2-9-6/h1-4,9H
(3)InChIKey: QDXKPEBYZPKXMM-UHFFFAOYAA