The CAS registry number of 6-amino-5-methylpyridin-3-ylboronic acid is 1032759-01-5. The molecular formula of it is C₆H₉BN₂O₂ and molecular weight is 151.9589. Its systematic name is called (6-amino-5-methyl-3-pyridyl)boronic acid.

Physical properties about this chemical are: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 4.71; (4)ACD/KOC (pH 7.4): 1.207; (5)#H bond acceptors: 4; (6)#H bond donors: 4; (7)#Freely Rotating Bonds: 3; (8)Index of Refraction: 1.572; (9)Molar Refractivity: 39.328 cm³; (10)Molar Volume: 119.471 cm³; (11)Surface Tension: 60.709 dyne/cm; (12)Density: 1.272 g/cm³; (13)Flash Point: 194.803 °C; (14)Enthalpy of Vaporization: 68.452 kJ/mol; (15)Boiling Point: 398.495 °C at 760 mmHg; (16)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: B(c1cc(c(nc1)N)C)(O)O
(2)InChI: InChI=1/C6H9BN2O2/c1-4-2-5(7(10)11)3-9-6(4)8/h2-3,10-11H,1H3,(H2,8,9)
(3)InChIKey: LVIPAYBVNBMLBM-UHFFFAOYAK