The 7-Amino-N-methyl-1,2,3,4-tetrahydroquinoline hydrochloride is an organic compound with the formula C₁₀H₁₄N₂^.HCl. The IUPAC name of this chemical is 1-methyl-3,4-dihydro-2H-quinolin-7-amine hydrochloride. With the CAS registry number 927684-97-7, it is also named as 7-quinolinamine, 1,2,3,4-tetrahydro-1-methyl-, hydrochloride (1:1). In addition, the molecular weight is 198.69.

The other characteristics of 7-Amino-N-methyl-1,2,3,4-tetrahydroquinoline hydrochloride can be summarized as: (1)ACD/LogP: 1.42; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.85; (4)ACD/LogD (pH 7.4): 1.4; (5)#H bond acceptors: 2; (6)#H bond donors: 2; (7)#Freely Rotating Bonds: 1; (8)Polar Surface Area: 29.26 Å²; (9)Enthalpy of Vaporization: 62.24 kJ/mol; (10)Vapour Pressure: 1.18E-05 mmHg at 25°C; (11)Exact Mass: 198.092376; (12)MonoIsotopic Mass: 198.092376; (13)Topological Polar Surface Area: 29.3; (14)Heavy Atom Count: 13; (15)Formal Charge: 0; (16)Complexity: 158.

People can use the following data to convert to the molecule structure. 
1. SMILES:Cl.Nc1ccc2CCCN(C)c2c1
2. InChI:InChI=1/C10H14N2.ClH/c1-12-6-2-3-8-4-5-9(11)7-10(8)12;/h4-5,7H,2-3,6,11H2,1H3;1H 
3. InChIKey:LPBQFAWSKKXLRD-UHFFFAOYAT
4. Std. InChI:InChI=1S/C10H14N2.ClH/c1-12-6-2-3-8-4-5-9(11)7-10(8)12;/h4-5,7H,2-3,6,11H2,1H3;1H
5. Std. InChIKey:LPBQFAWSKKXLRD-UHFFFAOYSA-N