The systematic name of this chemical is 7-chloro-3-methyl-1H-pyrrolo[3,2-c]quinoline-4-carboxylic acid. With the CAS registry number 202974-75-2, the molecular formula is C₁₃H₉ClN₂O₂.   

The other characteristics of 7-Chloro-3-methyl-1H-pyrrolo[3,2-c]quinoline-4-carboxylic acid can be summarized as: (1)ACD/LogP: 2.98; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0; (4)ACD/LogD (pH 7.4): 0; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 3; (8)ACD/KOC (pH 7.4): 2; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 65.98 Å²; (13)Index of Refraction: 1.777; (14)Molar Refractivity: 71.112 cm³; (15)Molar Volume: 169.967 cm³; (16)Polarizability: 28.191×10^-24 cm³; (17)Surface Tension: 77.52 dyne/cm; (18)Density: 1.534 g/cm³; (19)Flash Point: 269.179 °C; (20)Enthalpy of Vaporization: 83.661 kJ/mol; (21)Boiling Point: 521.476 °C at 760 mmHg; (22)Vapour Pressure: 0 mmHg at 25°C.

People can use the following data to convert to the molecule structure. 
1. SMILES:Clc3cc2nc(c1c(cnc1c2cc3)C)C(=O)O
2. InChI:InChI=1/C13H9ClN2O2/c1-6-5-15-11-8-3-2-7(14)4-9(8)16-12(10(6)11)13(17)18/h2-5,15H,1H3,(H,17,18)
3. InChIKey:CRZBDDRJPBFILI-UHFFFAOYAY
4. Std. InChI:InChI=1S/C13H9ClN2O2/c1-6-5-15-11-8-3-2-7(14)4-9(8)16-12(10(6)11)13(17)18/h2-5,15H,1H3,(H,17,18)
5. Std. InChIKey:CRZBDDRJPBFILI-UHFFFAOYSA-N