The 7-Chlorofuro[2,3-c]pyridine, with the CAS registry number 84400-99-7, is also known as Furo[2,3-c]pyridine, 7-chloro-. This chemical's molecular formula is C₇H₄ClNO and molecular weight is 153.56576. Its IUPAC name is called 7-chlorofuro[2,3-c]pyridine.

Physical properties of 7-Chlorofuro[2,3-c]pyridine: (1)ACD/LogP: 2.08; (2)ACD/LogD (pH 5.5): 2; (3)ACD/LogD (pH 7.4): 2; (4)ACD/BCF (pH 5.5): 23; (5)ACD/BCF (pH 7.4): 23; (6)ACD/KOC (pH 5.5): 324; (7)ACD/KOC (pH 7.4): 324; (8)#H bond acceptors: 2; (9)Index of Refraction: 1.624; (10)Molar Refractivity: 39.381 cm³; (11)Molar Volume: 111.518 cm³; (12)Surface Tension: 49.036 dyne/cm; (13)Density: 1.377 g/cm³; (14)Flash Point: 100.646 °C; (15)Enthalpy of Vaporization: 46.036 kJ/mol; (16)Boiling Point: 242.806 °C at 760 mmHg; (17)Vapour Pressure: 0.052 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CN=C(C2=C1C=CO2)Cl
(2)InChI: InChI=1S/C7H4ClNO/c8-7-6-5(1-3-9-7)2-4-10-6/h1-4H
(3)InChIKey: YJUYPLVLAHBYCM-UHFFFAOYSA-N