The 8-Quinolinol, 2-methyl-5,7-dinitro-, with the CAS registry number 38543-75-8, is also known as 5,7-Dinitro-8-hydroxy-2-methylquinoline. This chemical's molecular formula is C₁₀H₇N₃O₅ and molecular weight is 249.18. What's more, its systematic name is 2-Methyl-5,7-dinitroquinolin-8-ol.

Physical properties of 8-Quinolinol, 2-methyl-5,7-dinitro- are: (1)ACD/LogP: 2.44; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 8; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 3; (10)Polar Surface Area: 124.76 Å²; (11)Index of Refraction: 1.731; (12)Molar Refractivity: 61.984 cm³; (13)Molar Volume: 155.161 cm³; (14)Polarizability: 24.572×10^-24 cm³; (15)Surface Tension: 83.389 dyne/cm; (16)Density: 1.606 g/cm³; (17)Flash Point: 205.131 °C; (18)Enthalpy of Vaporization: 69.463 kJ/mol; (19)Boiling Point: 415.572 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: O=N(=O)c1cc(c2ccc(C)nc2c1O)N(=O)=O
(2)InChI: InChI=1S/C10H7N3O5/c1-5-2-3-6-7(12(15)16)4-8(13(17)18)10(14)9(6)11-5/h2-4,14H,1H3
(3)InChIKey: ADHKESAPGWSTIF-UHFFFAOYSA-N