The AH 7921, with the CAS registry number 55154-30-8, is also known as 1-(3,4-Dichlorobenzamidomethyl)cyclohexyldimethylamine. This chemical's molecular formula is C₁₆H₂₂Cl₂N₂O and molecular weight is 328.11. What's more, both its IUPAC name and systematic name are the same which is called AH 7921. It is an opioid analgesic drug selective for the mu opioid receptor, and having around the same potency as morphine.

Physical properties about AH 7921 are: (1)ACD/LogP: 4.055; (2)ACD/LogD (pH 5.5): 0.97; (3)ACD/LogD (pH 7.4): 1.51; (4)ACD/BCF (pH 5.5): 1.00; (5)ACD/BCF (pH 7.4): 2.01; (6)ACD/KOC (pH 5.5): 3.14; (7)ACD/KOC (pH 7.4): 10.82; (8)#H bond acceptors: 3; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 4; (11)Index of Refraction: 1.571; (12)Molar Refractivity: 88.326 cm3; (13)Molar Volume: 268.854 cm³; (14)Polarizability: 35.015 10-24cm³; (15)Surface Tension: 47.3160018920898 dyne/cm; (16)Density: 1.225 g/cm³; (17)Flash Point: 218.62 °C; (18)Enthalpy of Vaporization: 69.457 kJ/mol; (19)Boiling Point: 437.876 °C at 760 mmHg;

You can still convert the following datas into molecular structure:
(1) SMILES: Clc1ccc(cc1Cl)C(=O)NCC2(N(C)C)CCCCC2
(2) InChI: InChI=1S/C16H22Cl2N2O/c1-20(2)16(8-4-3-5-9-16)11-19-15(21)12-6-7-13(17)14(18)10-12/h6-7,10H,3-5,8-9,11H2,1-2H3,(H,19,21)
(3) InChIKey: JMZROFPPEXCTST-UHFFFAOYSA-N