The Acetic acid,2-(diphenylphosphino)-, ethyl ester, with CAS registry number 55552-24-4, has the systematic name of ethyl (diphenylphosphanyl)acetate. Besides this, it is also called (Ethoxycarbonylmethyl)diphenylphosphine. And the chemical formula of this chemical is C₁₆H₁₇O₂P. What's more, its EINECS is 259-703-8.

Physical properties of Acetic acid,2-(diphenylphosphino)-, ethyl ester: (1)ACD/LogP: 4.95; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4.95; (4)ACD/LogD (pH 7.4): 4.95; (5)ACD/BCF (pH 5.5): 3426.56; (6)ACD/BCF (pH 7.4): 3426.56; (7)ACD/KOC (pH 5.5): 11799.01; (8)ACD/KOC (pH 7.4): 11799.01; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 6; (12)Polar Surface Area: 39.89 Å²; (13)Flash Point: 176.2 °C; (14)Enthalpy of Vaporization: 61.43 kJ/mol; (15)Boiling Point: 367.7 °C at 760 mmHg; (16)Vapour Pressure: 1.34E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(OCC)CP(c1ccccc1)c2ccccc2
(2)InChI: InChI=1/C16H17O2P/c1-2-18-16(17)13-19(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3
(3)InChIKey: PSFGJGLKZFVIHY-UHFFFAOYAZ
(4)Std. InChI: InChI=1S/C16H17O2P/c1-2-18-16(17)13-19(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3
(5)Std. InChIKey: PSFGJGLKZFVIHY-UHFFFAOYSA-N