The Benzenamine,2,6-dichloro-N-(4-methoxyphenyl)-, with the CAS registry number 30124-19-7, is also known as 2,6-Dichloro-N-(4-Methoxyphenyl) benzenamine. This chemical's molecular formula is C₁₃H₁₁Cl₂NO and molecular weight is 268.1385. Its systematic name is called 2,6-dichloro-N-(4-methoxyphenyl)aniline. 

Physical properties of Benzenamine,2,6-dichloro-N-(4-methoxyphenyl)-: (1)ACD/LogP: 4.72; (2)ACD/LogD (pH 5.5): 4.72; (3)ACD/LogD (pH 7.4): 4.72; (4)ACD/BCF (pH 5.5): 2280.95; (5)ACD/BCF (pH 7.4): 2280.95; (6)ACD/KOC (pH 5.5): 8817.3; (7)ACD/KOC (pH 7.4): 8817.3; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.627; (12)Molar Refractivity: 72.09 cm³; (13)Molar Volume: 203.3 cm³; (14)Surface Tension: 45.7 dyne/cm; (15)Density: 1.318 g/cm³; (16)Flash Point: 163.3 °C; (17)Enthalpy of Vaporization: 59.06 kJ/mol; (18)Boiling Point: 346.4 °C at 760 mmHg; (19)Vapour Pressure: 5.76E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc2cccc(Cl)c2Nc1ccc(OC)cc1
(2)InChI: InChI=1/C13H11Cl2NO/c1-17-10-7-5-9(6-8-10)16-13-11(14)3-2-4-12(13)15/h2-8,16H,1H3
(3)InChIKey: BLFDNLHOYIEHMA-UHFFFAOYAT