The Benzenamine,3,3'-oxybis-, with the CAS registry number 15268-07-2, is also known as 3,3'-Oxybisbenzenamine. This chemical's molecular formula is C₁₂H₁₂N₂O and molecular weight is 200.23648. Its systematic name is called 3,3'-oxydianiline.

Physical properties of Benzenamine,3,3'-oxybis-: (1)ACD/LogP: 1.06; (2)ACD/LogD (pH 5.5): 1.03; (3)ACD/LogD (pH 7.4): 1.06; (4)ACD/BCF (pH 5.5): 3.49; (5)ACD/BCF (pH 7.4): 3.74; (6)ACD/KOC (pH 5.5): 83.37; (7)ACD/KOC (pH 7.4): 89.53; (8)#H bond acceptors: 3; (9)#H bond donors: 4; (10)#Freely Rotating Bonds: 4; (11)Index of Refraction: 1.665; (12)Molar Refractivity: 61.16 cm³; (13)Molar Volume: 164.5 cm³; (14)Surface Tension: 55.9 dyne/cm; (15)Density: 1.216 g/cm³; (16)Flash Point: 206.1 °C; (17)Enthalpy of Vaporization: 62.83 kJ/mol; (18)Boiling Point: 380.2 °C at 760 mmHg; (19)Vapour Pressure: 5.56E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O(c1cc(N)ccc1)c2cccc(c2)N
(2)InChI: InChI=1/C12H12N2O/c13-9-3-1-5-11(7-9)15-12-6-2-4-10(14)8-12/h1-8H,13-14H2
(3)InChIKey: LXJLFVRAWOOQDR-UHFFFAOYAA