The Benzenemethanol,4-(1-piperazinyl)-, with the CAS registry number 325796-35-8, is also known as 4-(1-Piperazinyl)benzyl alcohol. This chemical's molecular formula is C₁₁H₁₆N₂O and molecular weight is 192.26. What's more, its systematic name is [4-(piperazin-1-yl)phenyl]methanol. 

Physical properties of Benzenemethanol,4-(1-piperazinyl)- are: (1)ACD/LogP: -0.04; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 3; (8)#H bond donors: 2; (9)#Freely Rotating Bonds: 3; (10)Polar Surface Area: 35.5 Å²; (11)Index of Refraction: 1.57; (12)Molar Refractivity: 56.257 cm³; (13)Molar Volume: 171.551 cm³; (14)Polarizability: 22.302×10^-24cm³; (15)Surface Tension: 44.98 dyne/cm; (16)Density: 1.121 g/cm³; (17)Flash Point: 186.84 °C; (18)Enthalpy of Vaporization: 66.885 kJ/mol; (19)Boiling Point: 385.329 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: OCc1ccc(cc1)N2CCNCC2
(2)InChI: InChI=1S/C11H16N2O/c14-9-10-1-3-11(4-2-10)13-7-5-12-6-8-13/h1-4,12,14H,5-9H2
(3)InChIKey: KIXOTMSDWREREV-UHFFFAOYSA-N