The CAS registry number of Benzenesulfonic acid,4-decyl-, sodium salt (1:1) is 2627-06-7. This chemical is also named as Benzenesulfonic acid, p-decyl-, sodium salt. Its EINECS registry number is 220-093-3. In addition, its molecular formula is C₁₆H₂₅NaO₃S and molecular weight is 320.42267. Its systematic name and IUPAC name are the same which is called sodium 4-decylbenzenesulfonate.

Physical properties about Benzenesulfonic acid,4-decyl-, sodium salt (1:1) are: (1)ACD/LogP: 5.71; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 2.21; (4)ACD/LogD (pH 7.4): 2.21; (5)ACD/BCF (pH 5.5): 4.1; (6)ACD/BCF (pH 7.4): 4.09; (7)ACD/KOC (pH 5.5): 9.68; (8)ACD/KOC (pH 7.4): 9.65; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 10.

You can still convert the following datas into molecular structure:
(1)SMILES: [Na+].[O-]S(=O)(=O)c1ccc(cc1)CCCCCCCCCC
(2)InChI: InChI=1/C16H26O3S.Na/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(14-12-15)20(17,18)19;/h11-14H,2-10H2,1H3,(H,17,18,19);/q;+1/p-1
(3)InChIKey: RLJSXMVTLMHXJS-REWHXWOFAX