The Bispyribac-sodium, with the CAS registry number 125401-92-5, is also known as 2,6-Bis((4,6-dimethoxy-2-pyrimidinyl)oxy)-benzoic acid sodium salt. This chemical's molecular formula is C₁₉H₁₈N₄NaO₈ and molecular weight is 452.35. What's more, its systematic name is Sodium 2,6-bis[(4,6-dimethoxy-2-pyrimidinyl)oxy]benzoate. Its classification code is Herbicide. This chemical is a kind of low-toxic and super efficient herbicides, and it is mainly used for the prevention and control of weeds. Its storage temperature is 0 - 6 °C.

Physical properties of Bispyribac-sodium are: (1)#H bond acceptors: 12; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 11; (4)Polar Surface Area: 133.24 Å².

Preparation of Bispyribac-sodium: this chemical can be prepared by 2, 6-dihydroxy-benzoic acid and 2-methylsulfonyl-4, 6-dimethoxy pyrimidine at the anhydrous condition. This reaction will need reagent sodium hydride and solvent tetrahydrofuran. The yield is about 28%.

You can still convert the following datas into molecular structure:
(1)SMILES: [Na+].COc1nc(nc(OC)c1)Oc3cccc(Oc2nc(cc(OC)n2)OC)c3C([O-])=O
(2)Std. InChI: InChI=1S/C19H18N4O8.Na/c1-26-12-8-13(27-2)21-18(20-12)30-10-6-5-7-11(16(10)17(24)25)31-19-22-14(28-3)9-15(23-19)29-4;/h5-9H,1-4H3,(H,24,25);/q;+1/p-1
(3)Std. InChIKey: FUHMZYWBSHTEDZ-UHFFFAOYSA-M

The toxicity data is as follows: