The CAS register number of Cyclohexylhydrazinium hydrogen sulphate is 68143-28-2. It also can be called as Cyclohexylhydrazine/sulfuric acid,(1:x) and the IUPAC name about this chemical is Amino(cyclohexyl)azanium. The molecular formula about this chemical is C₆H₁₆N₂O₄S and the molecular weight is 212.26724.

Physical properties about Cyclohexylhydrazinium hydrogen sulphate are: (1)H-Bond Donor: 3; (2)H-Bond Acceptor: 5; (3)Rotatable Bond Count: 1; (4)Exact Mass: 212.083078; (5)MonoIsotopic Mass: 212.083078; (6)Topological Polar Surface Area: 128; (7)Heavy Atom Count: 13; (8)Complexity: 134; (9)Covalently-Bonded Unit Count: 2.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1CCC(CC1)[NH2+]N.OS(=O)(=O)[O-]
(2)InChI: InChI=1S/C6H14N2.H2O4S/c7-8-6-4-2-1-3-5-6;1-5(2,3)4/h6,8H,1-5,7H2;(H2,1,2,3,4)
(3)InChIKey: HYGTVVBJPFJRKV-UHFFFAOYSA-N