The CAS registry number of Ethanone, 1-(1-methyl-1H-imidazol-5-yl)- is 20970-50-7. Its molecular formula is C₆H₈N₂O and molecular weight is 124.1405. Its systematic name is called 1-(1-methyl-1H-imidazol-5-yl)ethanone.

Physical properties about Ethanone, 1-(1-methyl-1H-imidazol-5-yl)- are: (1)ACD/LogP: -0.06; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 9; (6)ACD/KOC (pH 7.4): 9; (7)#H bond acceptors: 3; (8)#H bond donors: 0; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.543; (11)Molar Refractivity: 35.135 cm³; (12)Molar Volume: 111.392 cm³; (13)Surface Tension: 37.537 dyne/cm; (14)Density: 1.114 g/cm³; (15)Flash Point: 128.256 °C; (16)Enthalpy of Vaporization: 52.77 kJ/mol; (17)Boiling Point: 288.46 °C at 760 mmHg; (18)Vapour Pressure: 0.002 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: CC(=O)c1cncn1C
(2)InChI: InChI=1/C6H8N2O/c1-5(9)6-3-7-4-8(6)2/h3-4H,1-2H3
(3)InChIKey: DARZKTBWZJGBSD-UHFFFAOYAA