The Imidazo[2,1-b]thiazole-6-methanol, with the CAS registry number 349480-74-6, is also known as Imidazo[2,1-b]thiazol-6-ylmethanol. This chemical's molecular formula is C₆H₆N₂OS and molecular weight is 154.19. What's more, its systematic name is imidazo[2,1-b][1,3]thiazol-6-ylmethanol. 

Physical properties of Imidazo[2,1-b]thiazole-6-methanol are: (1)ACD/LogP: 0.31; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 7.4): 0.263; (4)ACD/BCF (pH 5.5): 1; (5)ACD/KOC (pH 5.5): 3.458; (6)ACD/KOC (pH 7.4): 31.464; (7)#H bond acceptors: 3; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 2; (10)Polar Surface Area: 65.77 Å²; (11)Index of Refraction: 1.759; (12)Molar Refractivity: 40.767 cm³; (13)Molar Volume: 99.216 cm³; (14)Surface Tension: 68.523 dyne/cm; (15)Density: 1.554 g/cm³.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CSC2=NC(=CN21)CO
(2)InChI: InChI=1S/C6H6N2OS/c9-4-5-3-8-1-2-10-6(8)7-5/h1-3,9H,4H2
(3)InChIKey: GBUTVPCKMACQMG-UHFFFAOYSA-N