The L-Proline, 4-methylene-, with the CAS registry number 20309-87-9, is also known as 4-Methylene-DL-proline. This chemical's molecular formula is C₆H₉NO₂ and molecular weight is 127.1412. Its systematic name is called 4-methylidene-L-proline.

Physical properties of L-Proline, 4-methylene-: (1)ACD/LogP: 0.24; (2)ACD/LogD (pH 5.5): -2.26; (3)ACD/LogD (pH 7.4): -2.26; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 3; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.518; (12)Molar Refractivity: 32.59 cm³; (13)Molar Volume: 107.4 cm³; (14)Surface Tension: 42.5 dyne/cm; (15)Density: 1.18 g/cm³; (16)Flash Point: 116.6 °C; (17)Enthalpy of Vaporization: 55.84 kJ/mol; (18)Boiling Point: 269.2 °C at 760 mmHg; (19)Vapour Pressure: 0.00209 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)[C@H]1NCC(=C)/C1
(2)InChI: InChI=1/C6H9NO2/c1-4-2-5(6(8)9)7-3-4/h5,7H,1-3H2,(H,8,9)/t5-/m0/s1
(3)InChIKey: PEYQZZMUNYLHII-YFKPBYRVBP