This chemical is called L-Tryptophan, calcium salt (2:1), and it can also be named as Calcium di-L-tryptophanate. With the molecular formula of C₂₂H₂₂CaN₄O₄, its molecular weight is 446.51. The CAS registry number of this chemical is 71720-54-2.

Other characteristics of the L-Tryptophan, calcium salt (2:1) can be summarised as followings: (1)H-Bond Donor: 4; (2)H-Bond Acceptor: 6; (3)Rotatable Bond Count: 4; (4)Exact Mass: 446.126696; (5)MonoIsotopic Mass: 446.126696; (6)Topological Polar Surface Area: 164; (7)Heavy Atom Count: 31; (8)Formal Charge: 0; (9)Complexity: 239; (10)Isotope Atom Count: 0; (11)Defined Atom StereoCenter Count: 2; (12)Covalently-Bonded Unit Count: 3.

You can still convert the following datas into molecular structure: 
1.SMILES: c1ccc2c(c1)c(c[nH]2)C[C@@H](C(=O)[O-])N.c1ccc2c(c1)c(c[nH]2)C[C@@H](C(=O)[O-])N.[Ca+2]
2.InChI: InChI=1/2C11H12N2O2.Ca/c2*12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10;/h2*1-4,6,9,13H,5,12H2,(H,14,15);/q;;+2/p-2/t2*9-;/m00./s1 3.InChIKey: AJFVCQXKEUTYCR-XIKRXVFJBM