The Mercury,chloro(2-hydroxy-5-nitrophenyl)-, with the CAS registry number of 24579-90-6, is also known as Mercury, chloro(2-hydroxy-5-nitrophenyl)-. Its molecular formula is C₆H₄ClHgNO₃ and molecular weight is 374.14. What's more, its IUPAC name is Chloro-(2-hydroxy-5-nitrophenyl)mercury.

Physical properties about the Mercury,chloro(2-hydroxy-5-nitrophenyl)- are: (1)ACD/LogP: 1.60; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.36; (4)ACD/LogD (pH 7.4): -0.16; (5)ACD/BCF (pH 5.5): 5.58; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 101.93; (8)ACD/KOC (pH 7.4): 3.11; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 55.05 Å².

You can still convert the following datas into molecular structure:
(1) SMILES: O=[N+]([O-])c1cc([Hg]Cl)c(O)cc1
(2) InChI: InChI=1/C6H4NO3.ClH.Hg/c8-6-3-1-5(2-4-6)7(9)10;;/h1-3,8H;1H;/q;;+1/p-1/rC6H4ClHgNO3/c7-8-5-3-4(9(11)12)1-2-6(5)10/h1-3,10H
(3) InChIKey: VIMWCINSBRXAQH-GIZRFUOWAE