The 4-Piperidinone, 1,2,2,6,6-pentamethyl-, ethanedioate (1:1) has the CAS registry number 6636-26-6. This chemical's molecular formula is C₁₂H₂₁NO₅ and molecular weight is 259.14. What's more, its systematic name is 1,2,2,6,6-pentamethylpiperidin-4-one ethanedioate (1:1).

Physical properties of 4-Piperidinone, 1,2,2,6,6-pentamethyl-, ethanedioate (1:1) are: (1)ACD/LogP: 1.72; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 0; (6)Polar Surface Area: 20.31 Å²; (7)Flash Point: 79.6 °C; (8)Enthalpy of Vaporization: 45.45 kJ/mol; (9)Boiling Point: 218.1 °C at 760 mmHg; (10)Vapour Pressure: 0.128 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)C(=O)O.O=C1CC(N(C)C(C)(C)C1)(C)C
(2)Std. InChI: InChI=1S/C10H19NO.C2H2O4/c1-9(2)6-8(12)7-10(3,4)11(9)5;3-1(4)2(5)6/h6-7H2,1-5H3;(H,3,4)(H,5,6)
(3)Std. InChIKey: YQZGWYSFNGWCPV-UHFFFAOYSA-N