The Pentanoic acid,5-amino-, ethyl ester, with the CAS registry number 26342-05-2, is also known as Ethyl 5-aminovalerate. This chemical's molecular formula is C₇H₁₅NO₂ and molecular weight is 145.20. What's more, its systematic name is Ethyl 5-aminopentanoate.

Physical properties of Pentanoic acid,5-amino-, ethyl ester are: (1)ACD/LogP: 0.76; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 3; (8)#H bond donors: 2; (9)#Freely Rotating Bonds: 7; (10)Polar Surface Area: 52.32 Å²; (11)Index of Refraction: 1.439; (12)Molar Refractivity: 39.789 cm³; (13)Molar Volume: 151.242 cm³; (14)Polarizability: 15.774×10^-24 cm³; (15)Surface Tension: 33.704 dyne/cm; (16)Density: 0.96 g/cm³; (17)Flash Point: 62.01 °C; (18)Enthalpy of Vaporization: 42.66 kJ/mol; (19)Boiling Point: 190.398 °C at 760 mmHg; (20)Vapour Pressure: 0.542 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(OCC)CCCCN
(2)InChI: InChI=1/C7H15NO2/c1-2-10-7(9)5-3-4-6-8/h2-6,8H2,1H3
(3)InChIKey: YMYLIDVSLIIAPI-UHFFFAOYSA-N