Peroxydicarbonic acid,sodium salt (1:2)

The Peroxydicarbonic acid,sodium salt (1:2), with the CAS registry number 3313-92-6, is also known as Disodium peroxydicarbonate. This chemical's molecular formula is C₂Na₂O₆ and molecular weight is 166. What's more, its systematic name is called Disodium dioxybis(oxomethanolate).

Physical properties about Peroxydicarbonic acid,sodium salt (1:2) are: (1)ACD/LogP: -0.29; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -5; (4)ACD/LogD (pH 7.4): -5; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 6; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 93.06 Å²; (13)Flash Point: 145.1 °C; (14)Enthalpy of Vaporization: 59.51 kJ/mol; (15)Boiling Point: 300.9 °C at 760 mmHg; (16)Vapour Pressure: 0.000256 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: [Na+].[Na+].[O-]C(=O)OOC([O-])=O
(2) InChI: InChI=1/C2H2O6.2Na/c3-1(4)7-8-2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2
(3) InChIKey: VTIIJXUACCWYHX-NUQVWONBAP

The toxicity data is as follows: