The CAS register number of Pyrazolo[1,5-a]pyridine-2,3-dicarboxylicacid is 63237-87-6. It also can be called as Pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid 97%. The molecular formula about this chemical is C₉H₆N₂O₄ and the molecular weight is 206.15.

Physical properties about Pyrazolo[1,5-a]pyridine-2,3-dicarboxylicacid are: (1)ACD/LogP: 0.27; (2)ACD/LogD (pH 5.5): -3.87; (3)ACD/LogD (pH 7.4): -3.88; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 6; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 2; (11)Polar Surface Area: 69.9 Å²; (12)Index of Refraction: 1.718; (13)Molar Refractivity: 49.33 cm³; (14)Molar Volume: 125.1 cm³; (15)Polarizability: 19.55x10^-24cm³; (16)Surface Tension: 75.5 dyne/cm; (17)Density: 1.64 g/cm³. 

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)c1nn2c(c1C(=O)O)cccc2
(2)InChI: InChI=1/C9H6N2O4/c12-8(13)6-5-3-1-2-4-11(5)10-7(6)9(14)15/h1-4H,(H,12,13)(H,14,15)
(3)InChIKey: ALJPZXOFRCWHID-UHFFFAOYAG
(4)Std. InChI: InChI=1S/C9H6N2O4/c12-8(13)6-5-3-1-2-4-11(5)10-7(6)9(14)15/h1-4H,(H,12,13)(H,14,15)
(5)Std. InChIKey: ALJPZXOFRCWHID-UHFFFAOYSA-N