The Pyrido[2, 3-b]pyrazine-2, 3-dione, 1, 4-dihydro-, with the CAS registry number 2067-84-7, is also known as Pyrido[2, 3-b]pyrazine-2, 3-diol. And its EINECS registry number is 218-186-9. This chemical's molecular formula is C₇H₅N₃O₂ and molecular weight is 163.13. What's more, its IUPAC name is 1, 4-Dihydropyrido[2, 3-b]pyrazine-2, 3-dione.

Physical properties about Pyrido[2, 3-b]pyrazine-2, 3-dione, 1, 4-dihydro- are: (1)ACD/LogP: -1.29; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.29; (4)ACD/LogD (pH 7.4): -1.31; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 4.72; (8)ACD/KOC (pH 7.4): 4.55; (9)#H bond acceptors: 5; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 53.51 Å²; (13)Index of Refraction: 1.593; (14)Molar Refractivity: 38.86 cm³; (15)Molar Volume: 114.5 cm³; (16)Polarizability: 15.4×10^-24 cm³; (17)Surface Tension: 57 dyne/cm; (18)Density: 1.424 g/cm³.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C2Nc1c(nccc1)NC2=O
(2) InChI: InChI=1/C7H5N3O2/c11-6-7(12)10-5-4(9-6)2-1-3-8-5/h1-3H,(H,9,11)(H,8,10,12)
(3) InChIKey: ZTCJWOFMAWQWRD-UHFFFAOYAX

The toxicity data is as follows: