The Quinoline,4-iodo-6-methoxy-, with the CAS registry number 876492-00-1, is also known as 4-Iodo-6-methoxy-quinoline. This chemical's molecular formula is C₁₀H₈INO and molecular weight is 285.08109. Its IUPAC name is called 4-iodo-6-methoxyquinoline.

Physical properties of Quinoline,4-iodo-6-methoxy-: (1)ACD/LogP: 3.21; (2)ACD/LogD (pH 5.5): 3.2; (3)ACD/LogD (pH 7.4): 3.21; (4)ACD/BCF (pH 5.5): 158.58; (5)ACD/BCF (pH 7.4): 160.63; (6)ACD/KOC (pH 5.5): 1302.98; (7)ACD/KOC (pH 7.4): 1319.83; (8)#H bond acceptors: 2; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.683; (11)Molar Refractivity: 61.77 cm³; (12)Molar Volume: 162.8 cm³; (13)Surface Tension: 52.1 dyne/cm; (14)Density: 1.75 g/cm³; (15)Flash Point: 171.5 °C; (16)Enthalpy of Vaporization: 58.17 kJ/mol; (17)Boiling Point: 359.9 °C at 760 mmHg; (18)Vapour Pressure: 4.77E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: COC1=CC2=C(C=CN=C2C=C1)I
(2)InChI: InChI=1S/C10H8INO/c1-13-7-2-3-10-8(6-7)9(11)4-5-12-10/h2-6H,1H3
(3)InChIKey: NVLXYZOTINRMRQ-UHFFFAOYSA-N