The CAS registry number of Tetrasodium dihydrogen anthracene-1,4,5,8,9,10-hexolate is 93964-67-1. Its EINECS registry number is 300-913-7. This chemical's molecular formula is C₁₄H₆Na₄O₆ and molecular weight is 362.15292. Its IUPAC name is called tetrasodium; anthracene-1,4,5,8,9,10-hexolate; hydron.

Physical properties of Tetrasodium dihydrogen anthracene-1,4,5,8,9,10-hexolate: (1)H-Bond Donor: 0; (2)H-Bond Acceptor: 6; (3)Rotatable Bond Count: 0; (4)Exact Mass: 361.975517; (5)MonoIsotopic Mass: 361.975517; (6)Topological Polar Surface Area: 138; (7)Heavy Atom Count: 24; (8)Formal Charge: 0; (9)Complexity: 298; (10)Isotope Atom Count: 0; (11)Defined Atom StereoCenter Count: 0; (12)Undefined Atom StereoCenter Count: 0; (13)Defined Bond StereoCenter Count: 0; (14)Undefined Bond StereoCenter Count: 0; (15)Covalently-Bonded Unit Count: 7.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: [H+].[H+].C1=CC(=C2C(=C1[O-])C(=C3C(=CC=C(C3=C2[O-])[O-])[O-])[O-])[O-].[Na+].[Na+].[Na+].[Na+]
(2)InChI: InChI=1S/C14H10O6.4Na/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20;;;;/h1-4,15-20H;;;;/q;4*+1/p-4
(3)InChIKey: QDJIQFLYDMUMAG-UHFFFAOYSA-J