The Thymidine,5'-azido-5'-deoxy-, with the CAS registry number 19316-85-9, is also known as 5'-Azido-5'-deoxythymidine. This chemical's molecular formula is C₁₀H₁₃N₅O₄ and molecular weight is 267.24. What's more, its systematic name and its IUPAC name are the same which is called 1-[(2R,4S, 5R)-5-(Azidomethyl)-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.

Physical properties about Thymidine,5'-azido-5'-deoxy-: (1)# of Rule of 5 Violations: 0; (2)#H bond acceptors: 9; (3)#H bond donors: 2; (4)#Freely Rotating Bonds: 4; (5)Polar Surface Area: 71.44 Å².

You can still convert the following datas into molecular structure:
(1) SMILES: O=C/1NC(=O)N(\C=C\1C)[C@@H]2O[C@@H]([C@@H](O)C2)C/N=[N+]=[N-]
(2) InChI: InChI=1/C10H13N5O4/c1-5-4-15(10(18)13-9(5)17)8-2-6(16)7(19-8)3-12-14-11/h4,6-8,16H,2-3H2,1H3,(H,13,17,18)/t6-,7+,8+/m0/s1
(3) InChIKey: GKEHVJFBPNPCKI-XLPZGREQBP