Products Categories
CAS No.: | 1149-64-0 |
---|---|
Name: | 6-ETHYL-2-NAPHTHOL |
Molecular Structure: | |
Formula: | C14H22N2O |
Molecular Weight: | 250.341 |
Synonyms: | Acetamide,N-butyl-2-p-phenetidino- (7CI,8CI);N-Butyl-2-(4-ethoxyanilino)acetamide;N-Butyl-2-((4-ethoxyphenyl)amino)acetamide;FC 380;AC1MHGHF;NIOSH/AB4848000;LS-8413; |
Density: | 1.052 g/cm3 |
Boiling Point: | 464.5 °C at 760 mmHg |
Flash Point: | 234.7 °C |
PSA: | 20.23000 |
LogP: | 3.10780 |
The Acetamide,N-butyl-2-[(4-ethoxyphenyl)amino]- with CAS registry number of 1149-64-0 is also known as N-Butyl-2-((4-ethoxyphenyl)amino)acetamide. The IUPAC name is N-Butyl-2-(4-ethoxyanilino)acetamide. In addition, the formula is C14H22N2O and the molecular weight is 250.34.
Physical properties about this chemical are: (1)ACD/LogP: 1.97; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.96; (4)ACD/LogD (pH 7.4): 1.97; (5)ACD/BCF (pH 5.5): 18.22; (6)ACD/BCF (pH 7.4): 18.47; (7)ACD/KOC (pH 5.5): 276.87; (8)ACD/KOC (pH 7.4): 280.66; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 8; (12)Polar Surface Area: 32.78Å2; (13)Index of Refraction: 1.534; (14)Molar Refractivity: 73.96 cm3; (15)Molar Volume: 237.8 cm3; (16)Polarizability: 29.32×10-24cm3; (17)Surface Tension: 39 dyne/cm; (18)Density: 1.052 g/cm3; (19)Flash Point: 234.7 °C; (20)Enthalpy of Vaporization: 72.59 kJ/mol; (21)Boiling Point: 464.5 °C at 760 mmHg; (22)Vapour Pressure: 8.35E-09 mmHg at 25 °C.
You can still convert the following datas into molecular structure:
1. SMILES: O=C(NCCCC)CNc1ccc(OCC)cc1
2. InChI: InChI=1/C14H22N2O2/c1-3-5-10-15-14(17)11-16-12-6-8-13(9-7-12)18-4-2/h6-9,16H,3-5,10-11H2,1-2H3,(H,15,17)
3. InChIKey: FUIZRKMKYVALAS-UHFFFAOYAC
4. Std. InChI: InChI=1S/C14H22N2O2/c1-3-5-10-15-14(17)11-16-12-6-8-13(9-7-12)18-4-2/h6-9,16H,3-5,10-11H2,1-2H3,(H,15,17)
5. Std. InChIKey: FUIZRKMKYVALAS-UHFFFAOYSA-N