Products Categories
CAS No.: | 1741-01-1 |
---|---|
Name: | TRIMETHYLHYDRAZINE |
Article Data: | 10 |
Molecular Structure: | |
Formula: | C3H10N2 |
Molecular Weight: | 74.1258 |
Synonyms: | 1,1,2-Trimethylhydrazine;N,N,N'-Trimethylhydrazine;Trimethylhydrazine; |
Density: | 0.787 g/cm3 |
Melting Point: | -71.91°C |
Boiling Point: | 49.3 °C at 760 mmHg |
PSA: | 15.27000 |
LogP: | 0.07330 |
The Hydrazine, trimethyl-(6CI,7CI,8CI,9CI), with the CAS registry number 1741-01-1, is also known as N,N,N'-Trimethylhydrazine. This chemical's molecular formula is C3H10N2 and molecular weight is 74.12. What's more, both its IUPAC name and systematic name are the same which is called 1,1,2-Trimethylhydrazine.
Physical properties about Hydrazine, trimethyl-(6CI,7CI,8CI,9CI) are: (1)# of Rule of 5 Violations: 0; (2)#H bond acceptors: 2; (3)#H bond donors: 1; (4)#Freely Rotating Bonds: 1; (5)Index of Refraction: 1.408; (6)Molar Refractivity: 23.26 cm3; (7)Molar Volume: 94.1 cm3; (8)Polarizability: 9.22×10-24 cm3; (9)Surface Tension: 22.5 dyne/cm; (10)Density: 0.787 g/cm3; (11)Enthalpy of Vaporization: 29.28 kJ/mol; (12)Boiling Point: 49.3 °C at 760 mmHg; (13)Vapour Pressure: 300 mmHg at 25 °C.
You can still convert the following datas into molecular structure:
(1)SMILES: CNN(C)C
(2)InChI: InChI=1/C3H10N2/c1-4-5(2)3/h4H,1-3H3
(3)InChIKey: NIIPNAJXERMYOG-UHFFFAOYAX