Products Categories
CAS No.: | 22817-07-8 |
---|---|
Name: | Biguanide nitrate |
Molecular Structure: | |
Formula: | C2H7N5.HNO3 |
Molecular Weight: | 164.124 |
Synonyms: | Guanylguanidine nitrate |
Melting Point: | 202 °C |
PSA: | 177.82000 |
LogP: | 0.52940 |
The Biguanide nitrate, with CAS registry number 22817-07-8, has the systematic name of imidodicarbonimidic diamide, nitrate (1:1). Besides this, it is also called Guanylguanidine nitrate. Its molecular weight is 164.12. And the chemical formula of this chemical is C2H7N5.HNO3.
You can still convert the following datas into molecular structure:
(1)SMILES: C(=N)(N)NC(=N)N.[N+](=O)(O)[O-]
(2)InChI: InChI=1/C2H7N5.HNO3/c3-1(4)7-2(5)6;2-1(3)4/h(H7,3,4,5,6,7);(H,2,3,4)
(3)InChIKey: AVWOEAVWVDLXMA-UHFFFAOYAZ
(4)Std. InChI: InChI=1S/C2H7N5.HNO3/c3-1(4)7-2(5)6;2-1(3)4/h(H7,3,4,5,6,7);(H,2,3,4)
(5)Std. InChIKey: AVWOEAVWVDLXMA-UHFFFAOYSA-N