100683-81-6 Usage
General Description
The chemical compound 5-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxybenzo[b]thiophene-2-carboxamide dihydrochloride is a complex organic molecule with potential pharmacological properties. It consists of a benzo[b]thiophene ring with an amino group, a pyrrolidin-2-ylmethyl side chain, and a carboxamide functional group. The dihydrochloride salt form of this compound increases its solubility and stability. This chemical may have potential applications in the field of medicinal chemistry or drug development, particularly in the context of neuropharmacology or as a potential therapeutic agent for certain diseases or conditions. Further research and analysis are required to fully understand the properties and potential uses of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 100683-81-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,6,8 and 3 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 100683-81:
(8*1)+(7*0)+(6*0)+(5*6)+(4*8)+(3*3)+(2*8)+(1*1)=96
96 % 10 = 6
So 100683-81-6 is a valid CAS Registry Number.
InChI:InChI=1/C17H23N3O2S.2ClH/c1-3-20-8-4-5-12(20)10-19-17(21)16-15(22-2)13-9-11(18)6-7-14(13)23-16;;/h6-7,9,12H,3-5,8,10,18H2,1-2H3,(H,19,21);2*1H