100806-78-8 Usage
Description
(4-pyrimidin-2-ylphenyl)methanol, a chemical compound with the molecular formula C12H11NO, is a white to off-white crystalline powder. It is primarily utilized in the pharmaceutical industry as an intermediate for the synthesis of various pharmaceuticals, including antiviral and anticancer drugs. (4-pyrimidin-2-ylphenyl)methanol has also been investigated for its potential in the development of new materials for pharmaceutical formulations and as a building block for the synthesis of organic molecules with potential biological activity. Its versatility and applicability in pharmaceuticals and materials science make it a valuable compound for research and development.
Uses
Used in Pharmaceutical Industry:
(4-pyrimidin-2-ylphenyl)methanol is used as a chemical intermediate for the synthesis of various pharmaceuticals, such as antiviral and anticancer drugs, due to its unique molecular structure and reactivity.
Used in Pharmaceutical Formulation Development:
(4-pyrimidin-2-ylphenyl)methanol is used as a potential material in the development of new pharmaceutical formulations, enhancing the efficiency and effectiveness of drug delivery systems.
Used in Materials Science:
(4-pyrimidin-2-ylphenyl)methanol is used as a building block for the synthesis of organic molecules with potential biological activity, contributing to the advancement of materials with applications in various scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 100806-78-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,8,0 and 6 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 100806-78:
(8*1)+(7*0)+(6*0)+(5*8)+(4*0)+(3*6)+(2*7)+(1*8)=88
88 % 10 = 8
So 100806-78-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O/c14-8-9-2-4-10(5-3-9)11-12-6-1-7-13-11/h1-7,14H,8H2