101084-76-8 Usage
Description
3-Bromothiophene-4-boronic acid is a chemical compound with the formula C4H4BBrO2S. It is a boronic acid derivative of 3-bromothiophene, which is widely used in pharmaceutical and organic synthesis. 3-BROMOTHIOPHENE-4-BORONIC ACID is an important intermediate for the synthesis of various pharmaceuticals, agrochemicals, and organic materials. It can be used as a building block for the construction of complex molecules and has shown potential therapeutic and biological activities. The boronic acid group in the compound allows for easy modification and functionalization, making it a valuable tool in organic chemistry and drug discovery.
Uses
Used in Pharmaceutical Industry:
3-Bromothiophene-4-boronic acid is used as a key intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its versatile chemical structure enables the creation of complex molecules with potential therapeutic applications.
Used in Agrochemical Industry:
3-Bromothiophene-4-boronic acid is used as a building block in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can lead to the development of more effective and environmentally friendly products.
Used in Organic Synthesis:
3-Bromothiophene-4-boronic acid is used as a valuable tool in organic chemistry, particularly for the construction of complex organic molecules. Its boronic acid group allows for easy modification and functionalization, facilitating the synthesis of a wide range of compounds with diverse applications.
Used in Drug Discovery:
3-Bromothiophene-4-boronic acid is used as a potential therapeutic agent in drug discovery. Its biological activities and potential applications in medicine make it an important compound for further research and development in the pharmaceutical field.
Check Digit Verification of cas no
The CAS Registry Mumber 101084-76-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,0,8 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 101084-76:
(8*1)+(7*0)+(6*1)+(5*0)+(4*8)+(3*4)+(2*7)+(1*6)=78
78 % 10 = 8
So 101084-76-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H4BBrO2S/c6-4-2-9-1-3(4)5(7)8/h1-2,7-8H