101626-73-7 Usage
Chemical structure
2-[(2-propan-2-ylphenyl)sulfanylmethyl]-4,5-dihydroimidazole chloride consists of a 4,5-dihydroimidazole ring, a sulfanylmethyl group, and a 2-propan-2-ylphenyl group, with a chloride ion attached.
Functional groups
The compound contains a sulfanylmethyl group (-SCH3) and a 2-propan-2-ylphenyl group, which may contribute to its potential pharmacological properties and applications.
Ionic character
The presence of a chloride ion (Cl-) indicates that the compound has ionic character, which can affect its solubility and reactivity in various chemical reactions.
Potential pharmaceutical applications
The 4,5-dihydroimidazole ring is a common structural motif found in many bioactive compounds, suggesting that this compound may have potential uses in pharmaceuticals.
Antioxidant properties
The sulfanylmethyl group may give the compound potential as a thiol-based antioxidant, which could help protect cells from oxidative stress and damage.
Thiol-reactive drugs
The sulfanylmethyl group may also serve as a structural moiety in thiol-reactive drugs, which can be used for various therapeutic purposes.
Lipophilic properties
The 2-propan-2-ylphenyl group may confer lipophilic properties to the compound, potentially affecting its bioavailability and distribution within the body.
Further research
Further study of 2-[(2-propan-2-ylphenyl)sulfanylmethyl]-4,5-dihydroimidazole chloride's pharmacological properties and potential applications is warranted to better understand its potential uses in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 101626-73-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,6,2 and 6 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 101626-73:
(8*1)+(7*0)+(6*1)+(5*6)+(4*2)+(3*6)+(2*7)+(1*3)=87
87 % 10 = 7
So 101626-73-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H18N2S.ClH/c1-10(2)11-5-3-4-6-12(11)16-9-13-14-7-8-15-13;/h3-6,10H,7-9H2,1-2H3,(H,14,15);1H
