102387-48-4 Usage
General Description
The chemical 2-acetylamino-6-chloro-4-[(4-diethylamino)2-methylphenyl-imino]-5-methyl-1-oxo-2,5-cyclohexadiene is a complex compound with a long molecular structure. It contains an acetylamino group, a chlorine atom, and a diethylamino group, along with methyl and phenyl groups. It also has a cyclohexadiene ring structure. This chemical likely has a variety of potential uses and applications, given its unique combination of functional groups and structural features. However, due to its complexity and potentially reactive nature, it would require careful handling and thorough analysis to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 102387-48-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,3,8 and 7 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 102387-48:
(8*1)+(7*0)+(6*2)+(5*3)+(4*8)+(3*7)+(2*4)+(1*8)=104
104 % 10 = 4
So 102387-48-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H24ClN3O2/c1-6-24(7-2)15-8-9-16(12(3)10-15)23-17-11-18(22-14(5)25)20(26)19(21)13(17)4/h8-11,23H,6-7H2,1-5H3/b22-18-